Home
Products
Bruceine E
| Product Name | Bruceine E |
| Price: | $219 / 5mg |
| Catalog No.: | CN08318 |
| CAS No.: | 21586-90-3 |
| Molecular Formula: | C20H28O9 |
| Molecular Weight: | 412.43 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Brucea javanica (L.) Merr. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC1C=C(C)C2C(C1O)(C)C1C(O)C(O)C3(C4(C1(C(C2)OC(=O)C4O)CO3)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | |
| Density | 1.60±0.1 g/cm3 |
| PSA | 60.44000 |
| LogP | 4.80750 |
| Vapour Pressure | 1.16E-18mmHg at 25°C |
| Storage condition | 2-8℃ |