Home
Products
7,3',4'-Trihydroxyflavone
| Product Name | 7,3',4'-Trihydroxyflavone |
| Price: | Inquiry |
| Catalog No.: | CN05178 |
| CAS No.: | 2150-11-0 |
| Molecular Formula: | C15H10O5 |
| Molecular Weight: | 270.24 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The seeds of Cassia occidentalis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc2c(c1)oc(cc2=O)c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3′,4′,7-Trihydroxyflavone is a flavonoid aglycon compound isolated from broad bean pods[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 572.8±50.0 °C at 760 mmHg |
| Flash Point | 224.0±23.6 °C |
| Exact Mass | 270.052826 |
| PSA | 90.90000 |
| LogP | 2.84 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |