Home
Products
Demethylsuberosin
| Product Name | Demethylsuberosin |
| Price: | $117 / 10mg |
| Catalog No.: | CN06134 |
| CAS No.: | 21422-04-8 |
| Molecular Formula: | C14H14O3 |
| Molecular Weight: | 230.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The roots of Angelica dahuricae |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCc1cc2ccc(=O)oc2cc1O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Demethylsuberosin (7-Demethylsuberosin) is a coumarin compound isolated from Angelica gigas Nakai, and has anti-inflammatory activity[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 418.8±45.0 °C at 760 mmHg |
| Flash Point | 182.0±21.5 °C |
| Exact Mass | 230.094299 |
| PSA | 50.44000 |
| LogP | 3.67 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |