Home
Products
Magnoflorine
| Product Name | Magnoflorine |
| Price: | Inquiry |
| Catalog No.: | CN02115 |
| CAS No.: | 2141-09-5 |
| Molecular Formula: | C20H24NO4 |
| Molecular Weight: | 342.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The flowers of Magnolia liliiflora Desr. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc2c(c1O)c1c(O)c(OC)cc3c1C(C2)[N+](C)(C)CC3 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (+)-Magnoflorine (Magnoflorine) is an aporphine alkaloid found in Acoruscalamus, with anti-fungal activity, reduces the formation of C. albicans’ biofilm[1]. Anti-antidiabeticand anti-oxidative activity[2]. |
| Target | Fungal[1] |
| Exact Mass | 342.169983 |
| PSA | 58.92000 |
| LogP | -1.71 |
| Storage condition | 2-8C |