Home
Products
Chrysin dimethylether
| Product Name | Chrysin dimethylether |
| Price: | $62 / 20mg |
| Catalog No.: | CN04748 |
| CAS No.: | 21392-57-4 |
| Molecular Formula: | C17H14O4 |
| Molecular Weight: | 282.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Piper methysticum Forst. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(OC)c2c(c1)oc(cc2=O)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 5,7-Dimethoxyflavone is one of the major components of Kaempferia parviflora, has anti-obesity, anti-inflammatory, and antineoplastic effects. 5,7-Dimethoxyflavone inhibits cytochrome P450 (CYP) 3As. 5,7-Dimethoxyflavone is also a potent Breast Cancer Resistance Protein (BCRP) inhibitor[1][2]. |
| Target | CYP3A Breast Cancer Resistance Protein (BCRP) |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 476.6±45.0 °C at 760 mmHg |
| Flash Point | 213.4±28.8 °C |
| Exact Mass | 282.089203 |
| PSA | 48.67000 |
| LogP | 3.27 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |