Home
Products
Abscisic acid
| Product Name | Abscisic acid |
| Price: | $46 / 20mg |
| Catalog No.: | CN09425 |
| CAS No.: | 21293-29-8 |
| Molecular Formula: | C15H20O4 |
| Molecular Weight: | 264.32 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Cryst. |
| Source: | The herbs of Gossypium spp |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(=O)/C=C(C=C[C@@]1(O)C(=CC(=O)CC1(C)C)C)/C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Abscisic acid ((S)-(+)-Abscisic acid) is a plant hormone which is as a growth inhibitor. Abscisic acid has been shown to regulate many aspects of plant growth and development including embryo maturation, seed dormancy, germination, cell division and elongation, floral induction, and responses to environmental stresses such as drought, salinity, cold, pathogen attack and UV radiation[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 458.7±45.0 °C at 760 mmHg |
| Flash Point | 245.4±25.2 °C |
| Exact Mass | 264.136169 |
| PSA | 74.60000 |
| LogP | 1.70 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |