Home
Products
Cowaxanthone B
| Product Name | Cowaxanthone B |
| Price: | $526 / 5mg |
| Catalog No.: | CN05777 |
| CAS No.: | 212842-64-3 |
| Molecular Formula: | C25H28O6 |
| Molecular Weight: | 424.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Yellow powder |
| Source: | The peels of Garcinia mangostana L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(OC)cc2c(c1CC=C(C)C)c(=O)c1c(o2)cc(c(c1O)CC=C(C)C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cowaxanthone B is a xanthone isolated from the fruits of Garcinia cowa. Cowaxanthone B has weak antibacterial activity[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 621.9±55.0 °C at 760 mmHg |
| Flash Point | 210.4±25.0 °C |
| Exact Mass | 424.188599 |
| LogP | 6.04 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Storage condition | 2-8℃ |