Home
Products
Dendrobine
| Product Name | Dendrobine |
| Price: | $80 / 10mg |
| Catalog No.: | CN02217 |
| CAS No.: | 2115-91-5 |
| Molecular Formula: | C16H25NO2 |
| Molecular Weight: | 263.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Dendrobium nobile Lindl. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC([C@H]1[C@@H]2C(=O)O[C@H]1[C@@H]1[C@@]3([C@H]2CC[C@@H]3CN1C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dendrobine is an alkaloid isolated from Dendrobium nobile. Dendrobine possesses antiviral activity against influenza A viruses, with IC50s of 3.39 μM, 2.16 μM and 5.32 μM for A/FM-1/1/47 (H1N1), A/Puerto Rico/8/34 H274Y (H1N1) and A/Aichi/2/68 (H3N2), respectively[1]. |
| Target | IC50: 3.39 μM (A/FM-1/1/47), 2.16 μM (A/Puerto Rico/8/34 H274Y), 5.32 μM (A/Aichi/2/68)[1] |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 374.6±25.0 °C at 760 mmHg |
| Flash Point | 132.8±14.0 °C |
| Exact Mass | 263.188538 |
| PSA | 29.54000 |
| LogP | 1.88 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Storage condition | 2-8℃ |