Home
Products
Lycoramine
| Product Name | Lycoramine |
| Price: | $176 / 10mg |
| Catalog No.: | CN01068 |
| CAS No.: | 21133-52-8 |
| Molecular Formula: | C17H23NO3 |
| Molecular Weight: | 289.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Cryst. |
| Source: | The bulbs of Lycoris radiata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc2c3c1O[C@@H]1[C@]3(CC[C@@H](C1)O)CCN(C2)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Lycoramine, a dihydro-derivative of galanthamine, is isolated from Lycoris radiate. Lycoramine is a potent acetylcholinesterase (AChE) inhibitor[1][2]. |
| Target | AChE[1] |
| Density | 1.25 |
| Boiling Point | 436.4ºC at 760mmHg |
| Flash Point | 217.7ºC |
| Exact Mass | 289.16800 |
| PSA | 41.93000 |
| LogP | 2.01220 |
| Vapour Pressure | 2.17E-08mmHg at 25°C |
| Storage condition | 2-8°C |