Home
Products
Sakakin
| Product Name | Sakakin |
| Price: | $62 / 20mg |
| Catalog No.: | CN04077 |
| CAS No.: | 21082-33-7 |
| Molecular Formula: | C13H18O7 |
| Molecular Weight: | 286.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Curculigo orchioides Gaertn. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(C)cc(c2)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Orcinol glucoside (OG) is an active constituent isolated from Rhizoma Curculiginis, with antidepressant effects. Orcinol glucoside facilitates the shift of MSC fate to osteoblast and prevents adipogenesis via Wnt/β-catenin signaling pathway[1][2]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 570.6±50.0 °C at 760 mmHg |
| Flash Point | 298.9±30.1 °C |
| Exact Mass | 286.105255 |
| PSA | 119.61000 |
| LogP | -0.77 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Storage condition | ?20°C |