Home
Products
4-Methyldaphnetin
| Product Name | 4-Methyldaphnetin |
| Price: | Inquiry |
| Catalog No.: | CN06060 |
| CAS No.: | 2107-77-9 |
| Molecular Formula: | C10H8O4 |
| Molecular Weight: | 192.17 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The herbs of Daphne Korean Nakai |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=c1cc(C)c2c(o1)c(O)c(cc2)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 4-Methyldaphnetin is a precursor in the synthesis of derivatives of 4-methyl coumarin. 4-Methyldaphnetin has potent, selective anti-proliferative and apoptosis-inducing effects on several cancer cell lines. 4-Methyldaphnetin possesses radical scavenging property and strongly inhibits membrane lipid peroxidation[1][2][3]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 421.5±45.0 °C at 760 mmHg |
| Flash Point | 176.0±22.2 °C |
| Exact Mass | 192.042252 |
| PSA | 70.67000 |
| LogP | 1.95 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Storage condition | 2-8°C |