Home
Products
5,7-Dihydroxy-4-methylcoumarin
| Product Name | 5,7-Dihydroxy-4-methylcoumarin |
| Price: | $31 / 20mg |
| Catalog No.: | CN06059 |
| CAS No.: | 2107-76-8 |
| Molecular Formula: | C10H8O4 |
| Molecular Weight: | 192.17 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The herbs of Daphne Korean Nakai |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cc(O)c2c(c1)oc(=O)cc2C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 5,7-Dihydroxy-4-methylcoumarin is a coumarin derivative from Mexican tarragon[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 472.1±14.0 °C at 760 mmHg |
| Flash Point | 197.9±13.6 °C |
| Exact Mass | 192.042252 |
| PSA | 70.67000 |
| LogP | 2.58 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |