Home
Products
Amarogentin
| Product Name | Amarogentin |
| Price: | $103 / 20mg |
| Catalog No.: | CN03098 |
| CAS No.: | 21018-84-8 |
| Molecular Formula: | C29H30O13 |
| Molecular Weight: | 586.54 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The roots of Gentiana scabra Bunge |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H]2OC=C3[C@H]([C@H]2C=C)CCOC3=O)[C@@H]([C@H]([C@@H]1O)O)OC(=O)c1c(O)cc(cc1c1cccc(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Amarogentin is a secoiridoid glycoside that is mainly extracted from Swertia and Gentiana roots. Amarogentin exhibits many biological effects, including anti-oxidative, anti-tumour, and anti-diabetic activities. Amarogentin exerts hepatoprotective and immunomodulatory effects. Amarogentin promotes apoptosis, arrests G2/M cell cycle and downregulates of PI3K/Akt/mTOR signalling pathways. Amarogentin exerts beneficial vasculo-metabolic effect by activating AMPK[1][2][3]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 928.5±65.0 °C at 760 mmHg |
| Flash Point | 306.9±27.8 °C |
| Exact Mass | 586.168640 |
| PSA | 201.67000 |
| LogP | 2.79 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | -20C |