Home
Products
Obtucarbamate B
| Product Name | Obtucarbamate B |
| Price: | $351 / 5mg |
| Catalog No.: | CN01124 |
| CAS No.: | 20913-18-2 |
| Molecular Formula: | C11H14N2O4 |
| Molecular Weight: | 238.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Dracaena sanderiana |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)Nc1cccc(c1C)NC(=O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 266.6±40.0 °C at 760 mmHg |
| Flash Point | 115.0±27.3 °C |
| Exact Mass | 238.095352 |
| PSA | 76.66000 |
| LogP | 2.33 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |