Home
Products
Berberine
| Product Name | Berberine |
| Price: | $15 / 20mg |
| Catalog No.: | CN02119 |
| CAS No.: | 2086-83-1 |
| Molecular Formula: | C20H18NO4 |
| Molecular Weight: | 336.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Coptis chinensis Franch. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(OC)ccc2c1c[n+]1CCc3c(c1c2)cc1c(c3)OCO1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Berberine is a natural alkaline, reduces apoptosis, with potent anti-oxidative and anti-inflammatory effect[1]. |
| Exact Mass | 336.123047 |
| PSA | 40.80000 |
| LogP | -0.99 |