Home
Products
Isobavachalcone
| Product Name | Isobavachalcone |
| Price: | $46 / 20mg |
| Catalog No.: | CN05680 |
| CAS No.: | 20784-50-3 |
| Molecular Formula: | C20H20O4 |
| Molecular Weight: | 324.37 g/mol |
| Purity: | >=98% |
| Type of Compound: | Chalcones |
| Physical Desc.: | Powder |
| Source: | The fruits of Psoralea corylifolia L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCc1c(O)ccc(c1O)C(=O)/C=C/c1ccc(cc1)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isobavachalcone(Corylifolinin) is a chalcone constituent of Angelica keiskei, induces apoptosis in neuroblastoma.IC50 value:Target: Isobavachalcone inhibits platelet aggregation. Inhibitor of Epstein-Barr virus early antigen (EBV-EA) induction. Isobavachalcone exhibits potent inhibitory effect on skin tumor promotion. Potent inhibitor of MMP-2. Displays DNA strand-scission (cleaving) activity. Isobavachalcone hows antifungal activity. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 549.0±50.0 °C at 760 mmHg |
| Flash Point | 299.9±26.6 °C |
| Exact Mass | 324.136169 |
| PSA | 77.76000 |
| LogP | 5.21 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |