Home
Products
Norlichexanthone
| Product Name | Norlichexanthone |
| Price: | Inquiry |
| Catalog No.: | CN05837 |
| CAS No.: | 20716-98-7 |
| Molecular Formula: | C14H10O5 |
| Molecular Weight: | 258.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Powder |
| Source: | From Cucurbitaria sp. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cc(C)c2c(c1)oc1c(c2=O)c(O)cc(c1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Norlichexanthone is a compound isolated from the stem bark of Kandelia candel (L.) Druce, Rhizophoraceae[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 567.8±49.0 °C at 760 mmHg |
| Flash Point | 224.7±23.3 °C |
| Exact Mass | 258.052826 |
| PSA | 90.90000 |
| LogP | 2.01 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |