Home
Products
Cannabichromene
| Product Name | Cannabichromene |
| Price: | Inquiry |
| Catalog No.: | CN04078 |
| CAS No.: | 20675-51-8 |
| Molecular Formula: | C21H30O2 |
| Molecular Weight: | 314.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Oil |
| Source: | The herbs of Cannabis sativa. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCCCc1cc2OC(C)(CCC=C(C)C)C=Cc2c(c1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 428.7±45.0 °C at 760 mmHg |
| Flash Point | 174.2±23.0 °C |
| Exact Mass | 314.224579 |
| PSA | 29.46000 |
| LogP | 8.56 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Storage condition | -20°C |