Home
Products
Fortunellin
| Product Name | Fortunellin |
| Price: | Inquiry |
| Catalog No.: | CN04359 |
| CAS No.: | 20633-93-6 |
| Molecular Formula: | C28H32O14 |
| Molecular Weight: | 592.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Fortunella japonica |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(Oc2cc(O)c3c(c2)oc(cc3=O)c2ccc(cc2)OC)C(C(C1O)O)OC1OC(C)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.62g/cm3 |
| Boiling Point | 888.7ºC at 760 mmHg |
| Flash Point | 293.4ºC |
| Exact Mass | 592.17900 |
| PSA | 217.97000 |
| Vapour Pressure | 6.89E-34mmHg at 25°C |