Home
Products
Danmelittoside
| Product Name | Danmelittoside |
| Price: | $263 / 10mg |
| Catalog No.: | CN03036 |
| CAS No.: | 20633-72-1 |
| Molecular Formula: | C15H22O10 |
| Molecular Weight: | 362.33 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Rehmannia glutinosa |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1=C[C@H]([C@]2([C@@H]1[C@@H](OC=C2)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Monomelittoside is a natural compound. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 693.3±55.0 °C at 760 mmHg |
| Flash Point | 373.1±31.5 °C |
| Exact Mass | 362.121307 |
| PSA | 169.30000 |
| LogP | -3.05 |
| Vapour Pressure | 0.0±4.9 mmHg at 25°C |
| Storage condition | 2-8℃ |