Home
Products
Ergosterol peroxide
| Product Name | Ergosterol peroxide |
| Price: | Inquiry |
| Catalog No.: | CN02562 |
| CAS No.: | 2061-64-5 |
| Molecular Formula: | C28H44O3 |
| Molecular Weight: | 428.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The herbs of Isodon eriocalyx |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]1CC[C@]2([C@@]3(C1)OO[C@@]1([C@@H]2CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@@H](C(C)C)C)C)C)C=C3)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ergosterol peroxide is a steroid derivative and can be isolated from a variety of fungi, yeast, lichens or sponges. Ergosterol peroxide has anti-tumour, proapoptotic, anti-inflammatory, anti-mycobacterial, and anti-proliferative activities[1][2]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 499.7±45.0 °C at 760 mmHg |
| Flash Point | 256.0±28.7 °C |
| Exact Mass | 428.329041 |
| PSA | 38.69000 |
| LogP | 7.68 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |