Home
Products
Tetrahydromagnolol
| Product Name | Tetrahydromagnolol |
| Price: | $131 / 10mg |
| Catalog No.: | CN02684 |
| CAS No.: | 20601-85-8 |
| Molecular Formula: | C18H22O2 |
| Molecular Weight: | 270.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The barks of Magnolia officinalis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCc1ccc(c(c1)c1cc(CCC)ccc1O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tetrahydromagnolol (Magnolignan), a main metabolite of Magnolol, is a potent and selective cannabinoid CB2 receptor agonist with an EC50 of 170 nM and a Ki of 416 nM. Tetrahydromagnolol possesses 20-fold more selective for CB2 receptor than CB1 receptor. Tetrahydromagnolol is also a weak GPR55 receptor antagonist[1]. |
| Target | CB2:170 nM (EC50) CB2:416 nM (Ki) CB1:9010 nM (EC50) CB1:2260 nM (Ki) GPR55 receptor |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 400.5±40.0 °C at 760 mmHg |
| Flash Point | 182.2±21.9 °C |
| Exact Mass | 270.161987 |
| PSA | 40.46000 |
| LogP | 4.95 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |