Home
Products
Paederoside
| Product Name | Paederoside |
| Price: | $176 / 10mg |
| Catalog No.: | CN03102 |
| CAS No.: | 20547-45-9 |
| Molecular Formula: | C18H22O11S |
| Molecular Weight: | 446.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Paederia scandens (Lour.) Merr |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H]2OC=C3[C@@H]4[C@H]2C(=C[C@@H]4OC3=O)COC(=O)SC)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Paederoside is a monoterpene S-methyl thiocarbonate isolated from Paederia pertomentosa. Paederoside shows a high anti-tumor promoting activity against the Epstein-Barr virus activation[1]. |
| Target | IC50: Epstein-Barr virus[1] |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 737.3±70.0 °C at 760 mmHg |
| Flash Point | 399.7±35.7 °C |
| Exact Mass | 446.088287 |
| PSA | 186.51000 |
| LogP | -2.53 |
| Vapour Pressure | 0.0±5.5 mmHg at 25°C |