Home
Products
Pinocembrin 7-O-(3''-galloyl-4'',6''-(S)-hexahydroxydiphenoyl)-beta-D-glucose
| Product Name | Pinocembrin 7-O-(3''-galloyl-4'',6''-(S)-hexahydroxydiphenoyl)-beta-D-glucose |
| Price: | $190 / 5mg |
| Catalog No.: | CN04752 |
| CAS No.: | 205370-59-8 |
| Molecular Formula: | C42H32O21 |
| Molecular Weight: | 872.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Lindera strychnifolia |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CCC(C1NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C2CCCN2C(=O)C(NC(=O)CNC(=O)C(NC(=O)C(NC1=O)C)C)CC(C)C)Cc1c[nH]c2c1cccc2)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pinocembrin 7-O-[3''-O-galloyl-4'',6''-hexahydroxydiphenoyl]-β-D-glucoside is a flavanone compound. |