Home
Products
Talatisamine
| Product Name | Talatisamine |
| Price: | Inquiry |
| Catalog No.: | CN02026 |
| CAS No.: | 20501-56-8 |
| Molecular Formula: | C24H39NO5 |
| Molecular Weight: | 421.57 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Aconitum carmichaeli Debx. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC[C@]12CC[C@@H](C34[C@@H]2CC(C3N(C1)CC)[C@@]1([C@@H]2[C@H]4C[C@@H]([C@@H]2O)[C@H](C1)OC)O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Talatisamine, a aconitum alkaloid，is specific K+ channel blocker. Talatisamine attenuates beta-amyloid oligomers induced neurotoxicity in cultured cortical neurons[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 533.9±50.0 °C at 760 mmHg |
| Flash Point | 276.7±30.1 °C |
| Exact Mass | 421.282837 |
| PSA | 71.39000 |
| LogP | -0.50 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Storage condition | 2-8C |