Home
Products
Curzerenone
| Product Name | Curzerenone |
| Price: | Inquiry |
| Catalog No.: | CN09342 |
| CAS No.: | 20493-56-5 |
| Molecular Formula: | C15H18O2 |
| Molecular Weight: | 230.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Oil |
| Source: | The rhizomes of Curcuma zedoaria. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=C[C@@]1(C)Cc2occ(c2C(=O)[C@@H]1C(=C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Curzerenone is one of constituents of leaf essential oil extracted from L. pulcherrima. Shows slight inhibitory effective against E. coli[1]. |
| Target | Anti-bacteria (E. coli)[1] |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 320.6±42.0 °C at 760 mmHg |
| Flash Point | 148.2±20.6 °C |
| Exact Mass | 230.130676 |
| PSA | 30.21000 |
| LogP | 4.66 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |