Home
Products
2-(4-Hydroxybenzal)acetophenone
| Product Name | 2-(4-Hydroxybenzal)acetophenone |
| Price: | Inquiry |
| Catalog No.: | CN04393 |
| CAS No.: | 20426-12-4 |
| Molecular Formula: | C15H12O2 |
| Molecular Weight: | 224.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1)C=CC(=O)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 4-Hydroxychalcone is a chalcone metabolite with anti-angiogenic and anti-inflammatory activities. 4-Hydroxychalcone suppresses angiogenesis by suppression of growth factor pathway with no signs of cytotoxicity[1]. 4-Hydroxychalcone inhibits TNF-α induced NF-κB pathway activation and activates BMP signaling, reduces resistant hypertension (RH) by attenuating hyperaldosteronism and renal injury in mice[2]. |
| Target | NF-κB[2] |
| Exact Mass | 224.08400 |
| PSA | 37.30000 |
| LogP | 3.28830 |