Home
Products
Luteollin 5-glucoside
| Product Name | Luteollin 5-glucoside |
| Price: | Inquiry |
| Catalog No.: | CN05376 |
| CAS No.: | 20344-46-1 |
| Molecular Formula: | C21H20O11 |
| Molecular Weight: | 448.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Dracocephalum ruyschiana L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(O)cc3c2c(=O)cc(o3)c2ccc(c(c2)O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Luteolin 5-O-glucoside, a major flavonoidfrom Cirsium maackii, possesses anti-inflammatory activity. Luteolin 5-O-glucoside inhibits LPS-induced NO production and t-BHP-induced ROS generation. Luteolin 5-O-glucoside suppresses the expression of iNOS and COX-2 in macrophages[1]. |
| In Vitro | Luteolin 5-O-glucoside, at a non-toxic concentration, inhibits LPS-induced NO production and t-BHP-induced ROS generation in a dose-dependent manner in RAW 264.7 cells. Luteolin 5-O-glucoside also suppresses the expression of iNOS and COX-2 in LPS-stimulated macrophages[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 864.2±65.0 °C at 760 mmHg |
| Flash Point | 305.8±27.8 °C |
| Exact Mass | 448.100555 |
| PSA | 190.28000 |
| LogP | 0.13 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |