Home
Products
Methyl trans-3-(3,4,5-trimethoxyphenyl)acrylate
| Product Name | Methyl trans-3-(3,4,5-trimethoxyphenyl)acrylate |
| Price: | Inquiry |
| Catalog No.: | CN06903 |
| CAS No.: | 20329-96-8 |
| Molecular Formula: | C13H16O5 |
| Molecular Weight: | 252.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Piper longum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)/C=C/c1cc(OC)c(c(c1)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (E)-Methyl 3,4,5-trimethoxycinnamate is a bioactive natural phenylpropanoid. (E)-Methyl 3,4,5-trimethoxycinnamate suppresses inflammation in RAW264.7 macrophages and blocks macrophage-adipocyte interaction. (E)-Methyl 3,4,5-trimethoxycinnamate also has antiarrhythmic effect, leads to suppression of triggered activities in rabbit myocytes[1][2]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 370.6±37.0 °C at 760 mmHg |
| Flash Point | 163.5±26.5 °C |
| Exact Mass | 252.099777 |
| PSA | 53.99000 |
| LogP | 1.77 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |