Home
Products
Tiliroside
| Product Name | Tiliroside |
| Price: | $62 / 20mg |
| Catalog No.: | CN05460 |
| CAS No.: | 20316-62-5 |
| Molecular Formula: | C30H26O13 |
| Molecular Weight: | 594.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Agrimonia pilosa Ledeb. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=C(OCC1OC(Oc2c(oc3c(c2=O)c(O)cc(c3)O)c2ccc(cc2)O)C(C(C1O)O)O)C=Cc1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Tiliroside, a glycosidic flavonoid, possesses anti-diabetic activities. Tiliroside is a noncompetitive inhibitor of α-amylase with a Ki value of 84.2 μM. Tiliroside inhibits carbohydrate digestion and glucose absorption in the gastrointestinal tract[1]. |
| In Vitro | Tiliroside inhibits pancreatic α-amylase (IC50=0.28 mM) in vitro[1]. |
| In Vivo | In male ICR mice, the increase in postprandial plasma glucose levels was significantly suppressed in the Tiliroside-administered group[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 943.9±65.0 °C at 760 mmHg |
| Flash Point | 311.9±27.8 °C |
| Exact Mass | 594.137329 |
| PSA | 216.58000 |
| LogP | 3.83 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8°C |