Home
Products
Saponarin
| Product Name | Saponarin |
| Price: | $234 / 5mg |
| Catalog No.: | CN05279 |
| CAS No.: | 20310-89-8 |
| Molecular Formula: | C27H30O15 |
| Molecular Weight: | 594.52 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The seeds of Vaccaria segetalis |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(Oc2cc3oc(cc(=O)c3c(c2C2OC(CO)C(C(C2O)O)O)O)c2ccc(cc2)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Saponarin is a natural flavonoid isolated from Gypsophila trichotoma, with antioxidant, anti-inflammatory and hepatoprotective activities. Saponarin activates AMPK in a calcium-dependent manner, thus regulating gluconeogenesis and glucose uptake[1][2][3]. |
| Density | 1.723 g/cm3 |
| Boiling Point | 919.5ºC at 760 mmHg |
| Flash Point | 305.4ºC |
| Exact Mass | 594.15800 |
| PSA | 260.20000 |
| Vapour Pressure | 0mmHg at 25°C |
| Storage condition | 2-8℃ |