Home
Products
Homodihydrocapsaicin I
| Product Name | Homodihydrocapsaicin I |
| Price: | $293 / 5mg |
| Catalog No.: | CN06516 |
| CAS No.: | 20279-06-5 |
| Molecular Formula: | C19H31NO3 |
| Molecular Weight: | 321.45 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The fruits of Capsicum annuum L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(CNC(=O)CCCCCCCC(C)C)ccc1O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Homodihydrocapsaicin I is a kind of capsaicinoid from the fruits of Capsicum annuum[1]. |
| In Vitro | Homodihydrocapsaicin I has phytotoxic effects on seedling growth of lettuce and reduces the radical length of Lactuca sativa seedling[1]. |
| Density | 1.017g/cm3 |
| Boiling Point | 508ºC at 760 mmHg |
| Flash Point | 261ºC |
| Exact Mass | 321.23000 |
| PSA | 62.05000 |
| LogP | 5.24400 |
| Vapour Pressure | 6.08E-11mmHg at 25°C |