Home
Products
Glomeratose A
| Product Name | Glomeratose A |
| Price: | $161 / 10mg |
| Catalog No.: | CN06796 |
| CAS No.: | 202471-84-9 |
| Molecular Formula: | C24H34O15 |
| Molecular Weight: | 562.52 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The roots of Polygala tenuifolia |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(C(C1O)OC(=O)C=Cc1cc(OC)c(c(c1)OC)OC)(CO)OC1OC(CO)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Glomeratose A is a lactate dehydrogenase inhibitor, isolated from Polygala tenuifolia[1]. |
| Target | IC50: Lactate dehydrogenase[1] |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 826.5±65.0 °C at 760 mmHg |
| Flash Point | 274.9±27.8 °C |
| Exact Mass | 562.189758 |
| LogP | -1.33 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |