Home
Products
Hydroxygenkwanin
| Product Name | Hydroxygenkwanin |
| Price: | $77 / 10mg |
| Catalog No.: | CN05462 |
| CAS No.: | 20243-59-8 |
| Molecular Formula: | C16H12O6 |
| Molecular Weight: | 300.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Lobelia chinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c2c(c1)oc(cc2=O)c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Hydroxygenkwanin (7-O-Methylluteolin), a natural flavonoid compound, is one of the main components of Lilac Daphne. Hydroxygenkwanin has anti-oxidant ability, anti-glioma ability and anticancer effect[1][2]. |
| In Vitro | Hydroxygenkwanin (7-O-Methylluteolin) inhibits C6 glioma cell proliferation in a dose dependent manner[1]. Hydroxygenkwanin induces the cell cycle arrest by flow cytometry and inhibits colony formation ability and cell movement. Hydroxygenkwanin induces cell cycle arrest through p21 activation and causes intrinsic cell apoptosis pathway[2]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 602.7±55.0 °C at 760 mmHg |
| Flash Point | 230.6±25.0 °C |
| Exact Mass | 300.063385 |
| PSA | 100.13000 |
| LogP | 2.65 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |