Home
Products
Spiraeoside
| Product Name | Spiraeoside |
| Price: | $380 / 5mg |
| Catalog No.: | CN04361 |
| CAS No.: | 20229-56-5 |
| Molecular Formula: | C21H20O12 |
| Molecular Weight: | 464.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Filipendula ulmari |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2ccc(cc2O)c2oc3cc(O)cc(c3c(=O)c2O)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Spiraeoside, an orally active natural compound, exerts antioxidant activity, inhibits reactive oxygen species (ROS) and malondialdehyde production. Spiraeoside possesses antiallergic, anti-inflammatory and antitumor activities[1]. |
| In Vitro | Spiraeoside elevates HG stimulation-caused the decrease in the expression levels of p-Akt, nuclear Nrf2, and HO-1 in AC16 cells (the effects of Spiraeoside are reversedby LY294002)[1]. Spiraeoside protects AC16 cells against HG-induced oxidative stress, cell injury, and apoptosis[1]. Spiraeoside activates the PI3K/Akt/Nrf2 pathway in AC16 cells on exposure to HG[1]. Spiraeoside protects AC16 cells against HG-induced apoptosis through the PI3K/Akt/Nrf2 pathway[1]. Cell Viability Assay[1] Cell Line: AC16 cells. Concentration: 1, 5, 10, or 20 μM. Incubation Time: 0, 24, or 48 hours. Result: Inhibited AC16 cells viability (20 μM). |
| In Vivo | Spiraeoside (50 mg/kg, p.o.) shows ulcer preventive ability[2]. Animal Model: Male Wistar rats (6-8 weeks old)[2]. Dosage: 50 mg/kg. Administration: Oral gavage an hour before inducing the lesions. Result: Decreased severity of the formed lesions. |
| Density | 1.809g/cm3 |
| Boiling Point | 835.6ºC at 760mmHg |
| Flash Point | 294.6ºC |
| Exact Mass | 464.09500 |
| PSA | 210.51000 |
| Vapour Pressure | 1.28E-29mmHg at 25°C |
| Storage condition | ?20°C |