Home
Products
Kaempferol 7-O-rhamnoside
| Product Name | Kaempferol 7-O-rhamnoside |
| Price: | $424 / 5mg |
| Catalog No.: | CN04794 |
| CAS No.: | 20196-89-8 |
| Molecular Formula: | C21H20O10 |
| Molecular Weight: | 432.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Maytenus hookeri |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O[C@H]1[C@@H](O[C@H]([C@@H]([C@H]1O)O)C)Oc1cc(O)c2c(c1)oc(c(c2=O)O)c1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kaempferol-7-O-rhamnoside, isolated from Chimonanthus nitens Oliv. Leaves, is a potent α-glucosidase activity inhibitor. Kaempferol-7-O-rhamnoside is used for diabetes treatment[1]. |
| Target | α-glucosidase activity[1] |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 753.2±60.0 °C at 760 mmHg |
| Flash Point | 267.9±26.4 °C |
| Exact Mass | 432.105652 |
| PSA | 170.05000 |
| LogP | 1.70 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |