Home
Products
Ombuoside
| Product Name | Ombuoside |
| Price: | Inquiry |
| Catalog No.: | CN04983 |
| CAS No.: | 20188-85-6 |
| Molecular Formula: | C29H34O16 |
| Molecular Weight: | 638.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Scutellaria barbata D. Don |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1cc(O)c2c(c1)oc(c(c2=O)O[C@@H]1O[C@H](CO[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)[C@H]([C@@H]([C@H]1O)O)O)c1ccc(c(c1)O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ombuoside is a glycoside ombuoside isolated from Gynostemma pentaphyllum.Ombuoside has antimicrobial activity against several strains of gram-positive and gram-negative bacteria and the yeast Candida albicans[1]. Ombuoside has antioxidant effects by scavenging free radicals and ROS[2]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 947.6±65.0 °C at 760 mmHg |
| Flash Point | 308.6±27.8 °C |
| Exact Mass | 638.184692 |
| PSA | 247.43000 |
| LogP | 2.17 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |