Home
Products
Magnolioside
| Product Name | Magnolioside |
| Price: | $321 / 10mg |
| Catalog No.: | CN06144 |
| CAS No.: | 20186-29-2 |
| Molecular Formula: | C16H18O9 |
| Molecular Weight: | 354.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The herbs of Artemisia scoparia. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc3ccc(=O)oc3cc2OC)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Magnolioside, isolated from Angelica gigas Nakai (Umbelliferae), exhibits significant neuroprotective activities against glutamate-induced toxicity[1]. |
| Exact Mass | 354.09500 |
| PSA | 138.82000 |