Home
Products
1-Formyl-beta-carboline
| Product Name | 1-Formyl-beta-carboline |
| Price: | Inquiry |
| Catalog No.: | CN00035 |
| CAS No.: | 20127-63-3 |
| Molecular Formula: | C12H8N2O |
| Molecular Weight: | 196.2 g/mol |
| Purity: | >95% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The leaves of Ailanthus altissima |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=Cc1nccc2c1[nH]c1c2cccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 440.8±25.0 °C at 760 mmHg |
| Flash Point | 220.8±29.6 °C |
| Exact Mass | 196.063660 |
| PSA | 45.75000 |
| LogP | 2.51 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |