Home
Products
Xanthotoxol
| Product Name | Xanthotoxol |
| Price: | Inquiry |
| Catalog No.: | CN06293 |
| CAS No.: | 2009-24-7 |
| Molecular Formula: | C11H6O4 |
| Molecular Weight: | 202.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The fruits of Cnidium monnieri. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=c1ccc2c(o1)c(O)c1c(c2)cco1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Xanthotoxol is a biologically active linear furocoumarin, shows strong pharmacological activities as anti-inflammatory, antioxidant, 5-HT antagonistic, and neuroprotective effects. |
| Target | 5-HT[1] |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 428.1±45.0 °C at 760 mmHg |
| Flash Point | 212.7±28.7 °C |
| Exact Mass | 202.026611 |
| PSA | 63.58000 |
| LogP | 0.72 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Storage condition | -20°C |