Home
Products
Diosbulbin B
| Product Name | Diosbulbin B |
| Price: | $69 / 20mg |
| Catalog No.: | CN08879 |
| CAS No.: | 20086-06-0 |
| Molecular Formula: | C19H20O6 |
| Molecular Weight: | 344.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Dioscorea bulbifera |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1O[C@H]2C[C@@H]1[C@H]1[C@H]3OC(=O)[C@]4(C3)[C@@]([C@@H]1C2)(C)C[C@@H](O4)c1cocc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Diosbulbin B is a diterpene lactone isolated from D. bulbifera L., with anti-tumor activity. Diosbulbin B can induce liver injury[1][2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 574.8±50.0 °C at 760 mmHg |
| Flash Point | 301.4±30.1 °C |
| Exact Mass | 344.125977 |
| PSA | 74.97000 |
| LogP | -0.41 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Storage condition | 2-8C |