Home
Products
Isoscoparin
| Product Name | Isoscoparin |
| Price: | $176 / 5mg |
| Catalog No.: | CN04629 |
| CAS No.: | 20013-23-4 |
| Molecular Formula: | C22H22O11 |
| Molecular Weight: | 462.40 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The seeds of Alliaria petiolata. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(C(C(C1O)O)O)c1c(O)cc2c(c1O)c(=O)cc(o2)c1ccc(c(c1)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isoscoparin is a flavonoid that could be isolated from EtOAc extract of Gentiana algida Pall. Isoscoparin possesses antioxidant activity[1]. |
| Boiling Point | 818.6±65.0 °C(Predicted) |
| Exact Mass | 462.11600 |
| PSA | 190.28000 |
| LogP | 0.10030 |