Home
Products
Isorubrofusarin 10-gentiobioside
| Product Name | Isorubrofusarin 10-gentiobioside |
| Price: | $424 / 5mg |
| Catalog No.: | CN03430 |
| CAS No.: | 200127-93-1 |
| Molecular Formula: | C27H32O15 |
| Molecular Weight: | 596.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The seeds of Cassia obtusifolia L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1cc(O[C@@H]2O[C@H](CO[C@@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O)[C@H]([C@@H]([C@H]2O)O)O)c2c(c1)cc(c1c2oc(C)cc1=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isorubrofusarin-6-O-β-gentiobioside (Isorubrofusarin gentiobioside) is a naphthopyrone glycoside isolated from Cassia obtusifolia Linn seeds[1]. |