Home
Products
N-trans-Sinapoyltyramine
| Product Name | N-trans-Sinapoyltyramine |
| Price: | $293 / 5mg |
| Catalog No.: | CN00710 |
| CAS No.: | 200125-11-7 |
| Molecular Formula: | C19H21NO5 |
| Molecular Weight: | 343.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Litsea hypophaea |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(/C=C/C(=O)NCCc2ccc(cc2)O)cc(c1O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | N-trans-Sinapoyltyramine is an alkaloid. N-trans-Sinapoyltyramine can be isolated from Lindera glauca Sieb Zucc[1]. |
| Storage condition | 2-8℃ |