Home
Products
Veraguensin
| Product Name | Veraguensin |
| Price: | $277 / 10mg |
| Catalog No.: | CN02803 |
| CAS No.: | 19950-55-1 |
| Molecular Formula: | C22H28O5 |
| Molecular Weight: | 372.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Acorus tatarinowii |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(ccc1OC)C1OC(C(C1C)C)c1ccc(c(c1)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Veraguensin is a lignan compound derived from Magnolia sp.. Veraguensin can inhibit bone resorption[1] |
| Density | 1.082±0.06 g/cm3 |
| Boiling Point | 479.1±45.0℃(Predicted) |
| Exact Mass | 372.19400 |
| PSA | 46.15000 |
| LogP | 4.80580 |
| Vapour Pressure | 7.04E-09mmHg at 25°C |