Home
Products
Maackiain
| Product Name | Maackiain |
| Price: | $169 / 20mg |
| Catalog No.: | CN05492 |
| CAS No.: | 19908-48-6 |
| Molecular Formula: | C16H12O5 |
| Molecular Weight: | 284.27 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The flowers of Maackia amurensis Rupr.et Maxim. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc2c(c1)OCC1C2Oc2c1cc1c(c2)OCO1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Maackiain (DL-Maackiain) is isolated from Maackia amurensis Rupr.et Maxim. Maackiain (DL-Maackiain) is a larvicidal agent against Aedes aegypti mosquito.xp Parasitol with a LD50 of 21.95 µg/mL[1]. Maackiain (DL-Maackiain) induces fragmentations of DNA to oligonucleosomal-sized fragments that like a characteristic of apoptosis in the HL-60 cells[2]. |
| Target | LD50: 21.95 µg/mL (Aedes aegypti mosquito.xp Parasitol)[1] |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 436.2±45.0 °C at 760 mmHg |
| Flash Point | 217.6±28.7 °C |
| Exact Mass | 284.068481 |
| PSA | 57.15000 |
| LogP | 2.79 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Storage condition | 2-8C |