Home
Products
(-)-Myrtenol
| Product Name | (-)-Myrtenol |
| Price: | Inquiry |
| Catalog No.: | CN09603 |
| CAS No.: | 19894-97-4 |
| Molecular Formula: | C10H16O |
| Molecular Weight: | 152.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Monoterpenoids |
| Physical Desc.: | Oil |
| Source: | The essential oil of Myrtus communis L. (Myrtaceae) |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCC1=CC[C@H]2C[C@@H]1C2(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 0.981 g/mL at 20 °C(lit.) |
| Boiling Point | 221-222 °C(lit.) |
| Flash Point | 193 °F |
| Exact Mass | 152.12000 |
| PSA | 20.23000 |
| LogP | 1.97110 |
| Storage condition | 2-8°C |