Home
Products
Continentalic acid
| Product Name | Continentalic acid |
| Price: | $158 / 10mg |
| Catalog No.: | CN08488 |
| CAS No.: | 19889-23-7 |
| Molecular Formula: | C20H30O2 |
| Molecular Weight: | 302.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Aralia continentalis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=CC1(C)CCC2C(=C1)CCC1C2(C)CCCC1(C)C(=O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Continentalic acid from Aralia continentalis has minimum inhibitory concentrations (MICs) of approximately 8-16 µg/mL against S. aureus, including the Methicillin susceptible Staphylococcus aureus (MSSA) and Methicillin-resistant Staphylococcus aureus (MRSA) standard strains[1]. |
| Storage condition | 2-8℃ |