Home
Products
Humulene epoxide II
| Product Name | Humulene epoxide II |
| Price: | Inquiry |
| Catalog No.: | CN09484 |
| CAS No.: | 19888-34-7 |
| Molecular Formula: | C15H24O |
| Molecular Weight: | 220.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Solid |
| Source: | The rhizomes of Zingiber officinale Roscoe |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C/1=CCC(C)(C)/C=C/C[C@@]2([C@@H](CC1)O2)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Humulene oxide II is an essential oil component from Zingiber striolatum Diels flowers, leaves and stems. Humulene oxide II has cytotoxicity against A549, PC-3 and K562 cell lines[1]. |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 285.6±29.0 °C at 760 mmHg |
| Flash Point | 123.3±22.3 °C |
| Exact Mass | 220.182709 |
| PSA | 12.53000 |
| LogP | 5.04 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |