Home
Products
Alisol A
| Product Name | Alisol A |
| Price: | $77 / 20mg |
| Catalog No.: | CN07644 |
| CAS No.: | 19885-10-0 |
| Molecular Formula: | C30H50O5 |
| Molecular Weight: | 490.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The tubers of Alisma plantago-aquatica Linn. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]([C@H](C(O)(C)C)O)C[C@H](C1=C2C[C@H](O)[C@@H]3[C@]([C@]2(CC1)C)(C)CC[C@@H]1[C@]3(C)CCC(=O)C1(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Alisol A is a natural product. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 629.3±55.0 °C at 760 mmHg |
| Flash Point | 348.4±28.0 °C |
| Exact Mass | 490.365814 |
| PSA | 97.99000 |
| LogP | 3.99 |
| Vapour Pressure | 0.0±4.2 mmHg at 25°C |
| Storage condition | -20°C |